Products 1310383-75-5
CAS 1310383-75-5 appears in our catalog under these names: 1,7-Dimethylindazole-5-boronic acid, 98%, 1,7-Dimethylindazole-5-boronic acid 95%, (1,7-dimethyl-1H-indazol-5-yl)boronic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 250mg, 1g, 10g, 5g, 100mg.
(1,7-dimethylindazol-5-yl)boronic acid (CAS 1310383-75-5) is a chemical compound with the molecular formula C9H11BN2O2 and a molecular weight of 190.01 g/mol. IUPAC name: (1,7-dimethylindazol-5-yl)boronic acid. InChIKey: YOKNKBHSACYLPB-UHFFFAOYSA-N.
| Molecular formula | C9H11BN2O2 |
|---|---|
| Molecular weight | 190.01 g/mol |
| IUPAC name | (1,7-dimethylindazol-5-yl)boronic acid |
| InChIKey | YOKNKBHSACYLPB-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C2C(=C1)C=NN2C)C)(O)O |
Computed by PubChem (NCBI)
Synonyms:
1,7-Dimethyl-1H-indazole-5-boronic acid, (1,7-Dimethyl-1H-indazol-5-yl)boronic acid, 1,7-Dimethylindazole-5-boronic acid, 1,7-Dimethyl-1H-indazol-5-yl-5-boronic acid, (1,7-dimethylindazol-5-yl)boronic acid, 5-Borono-1,7-dimethyl-1H-imidazole, Boronic acid, B-(1,7-dimethyl-1H-indazol-5-yl)-, 1,7-Dimethylindazole-5-boronicacid, B-(1,7-dimethyl-1h-indazol-5-yl)boronic acid