Products 1310405-36-7
CAS 1310405-36-7 appears in our catalog under these names: 1,4-Dimethyl-1h-indazole-5-boronic acid, 98%, 1,4-Dimethyl-1H-indazol-5-yl-5-boronic acid 95%, 1,4-Dimethyl-1H-indazole-5-boronic acid, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 250mg, 5g, 1g, 100mg, 25g.
(1,4-dimethylindazol-5-yl)boronic acid (CAS 1310405-36-7) is a chemical compound with the molecular formula C9H11BN2O2 and a molecular weight of 190.01 g/mol. IUPAC name: (1,4-dimethylindazol-5-yl)boronic acid. InChIKey: ATHVOUQWKYPARY-UHFFFAOYSA-N.
| Molecular formula | C9H11BN2O2 |
|---|---|
| Molecular weight | 190.01 g/mol |
| IUPAC name | (1,4-dimethylindazol-5-yl)boronic acid |
| InChIKey | ATHVOUQWKYPARY-UHFFFAOYSA-N |
| SMILES | B(C1=C(C2=C(C=C1)N(N=C2)C)C)(O)O |
Computed by PubChem (NCBI)
Synonyms:
1,4-Dimethyl-1H-indazole-5-boronic acid, 1,4-Dimethyl-1H-indazol-5-yl-5-boronic acid, (1,4-Dimethyl-1H-indazol-5-yl)boronic acid, (1,4-dimethylindazol-5-yl)boronic acid, Boronic acid, B-(1,4-dimethyl-1H-indazol-5-yl)-, ATHVOUQWKYPARY-UHFFFAOYSA-N, 1,4-dimethyl-indazole-5-boronic acid, 1,4-dimethyl-1H-indazol-5-yl-5-boronicacid, B-(1,4-dimethyl-1h-indazol-5-yl)boronic acid, 1,4-Dimethyl-1H-indazole-5-boronic acid(contains varying amounts of Anhydride)