Products 1310383-98-2
CAS 1310383-98-2 appears in our catalog under these names: 1,5-Dimethyl-1H-indazole-6-boronic acid, 98%, 98%, 1,5-Dimethyl-1h-indazole-6-boronic acid, 97%, 1,5-Dimethyl-1H-indazole-6-boronic acid 95%, 1,5-Dimethyl-1H-indazole-6-boronic acid, 98%. Offered by: Chemat, Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 25g, 5g, 500mg.
(1,5-dimethylindazol-6-yl)boronic acid (CAS 1310383-98-2) is a chemical compound with the molecular formula C9H11BN2O2 and a molecular weight of 190.01 g/mol. IUPAC name: (1,5-dimethylindazol-6-yl)boronic acid. InChIKey: JGAHSLPFNPGSNM-UHFFFAOYSA-N.
| Molecular formula | C9H11BN2O2 |
|---|---|
| Molecular weight | 190.01 g/mol |
| IUPAC name | (1,5-dimethylindazol-6-yl)boronic acid |
| InChIKey | JGAHSLPFNPGSNM-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1C)C=NN2C)(O)O |
Computed by PubChem (NCBI)
Synonyms:
1,5-Dimethyl-1H-indazole-6-boronic acid, 1,5-Dimethyl-1H-indazol-6-yl-6-boronic acid, (1,5-dimethylindazol-6-yl)boronic acid, Boronic acid, B-(1,5-dimethyl-1H-indazol-6-yl)-, (1,5-dimethyl-1H-indazol-6-yl)boronic acid, 6-Borono-1,5-dimethyl-1H-indazole, s11191, 1,5-Dimethyl-1H-indazole-6-boronicacid, 1,5-dimethyl-1H-indazol-6-yl-6-boronic acid - [D82272]