CAS 2250340-63-5 is the registry number for 2,3-Dimethyl-2h-indazole-7-boronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g.
(2,3-dimethylindazol-7-yl)boronic acid (CAS 2250340-63-5) is a chemical compound with the molecular formula C9H11BN2O2 and a molecular weight of 190.01 g/mol. IUPAC name: (2,3-dimethylindazol-7-yl)boronic acid. InChIKey: HDQPHXLDAYNJDB-UHFFFAOYSA-N.
| Molecular formula | C9H11BN2O2 |
|---|---|
| Molecular weight | 190.01 g/mol |
| IUPAC name | (2,3-dimethylindazol-7-yl)boronic acid |
| InChIKey | HDQPHXLDAYNJDB-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC2=C(N(N=C12)C)C)(O)O |
Computed by PubChem (NCBI)