CAS 1256094-30-0 appears in our catalog under these names: 6-Methanesulfonyl-2-(pyridin-2-yl)-1H-1,3-benzodiazole, 95%, 6-Methanesulfonyl-2-(pyridin-2-yl)-1H-1,3-benzodiazole. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
6-methylsulfonyl-2-pyridin-2-yl-1H-benzimidazole (CAS 1256094-30-0) is a chemical compound with the molecular formula C13H11N3O2S and a molecular weight of 273.31 g/mol. IUPAC name: 6-methylsulfonyl-2-pyridin-2-yl-1H-benzimidazole. InChIKey: VZAAGGBNTMRUDW-UHFFFAOYSA-N.
| Molecular formula | C13H11N3O2S |
|---|---|
| Molecular weight | 273.31 g/mol |
| IUPAC name | 6-methylsulfonyl-2-pyridin-2-yl-1H-benzimidazole |
| InChIKey | VZAAGGBNTMRUDW-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC2=C(C=C1)N=C(N2)C3=CC=CC=N3 |
Computed by PubChem (NCBI)