CAS 1256358-47-0 is the registry number for 3-(3,4-Dichlorophenylmethoxy)phenylboronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
[3-[(3,4-dichlorophenyl)methoxy]phenyl]boronic acid (CAS 1256358-47-0) is a chemical compound with the molecular formula C13H11BCl2O3 and a molecular weight of 296.9 g/mol. IUPAC name: [3-[(3,4-dichlorophenyl)methoxy]phenyl]boronic acid. InChIKey: JEJDEZZCBNZPMW-UHFFFAOYSA-N.
| Molecular formula | C13H11BCl2O3 |
|---|---|
| Molecular weight | 296.9 g/mol |
| IUPAC name | [3-[(3,4-dichlorophenyl)methoxy]phenyl]boronic acid |
| InChIKey | JEJDEZZCBNZPMW-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)OCC2=CC(=C(C=C2)Cl)Cl)(O)O |
Computed by PubChem (NCBI)