CAS 1256482-82-2 is the registry number for 2-(2-Bromo-3,6-difluorophenyl)acetonitrile. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(2-bromo-3,6-difluorophenyl)acetonitrile (CAS 1256482-82-2) is a chemical compound with the molecular formula C8H4BrF2N and a molecular weight of 232.02 g/mol. IUPAC name: 2-(2-bromo-3,6-difluorophenyl)acetonitrile. InChIKey: VMVUSXZOFRZMBU-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF2N |
|---|---|
| Molecular weight | 232.02 g/mol |
| IUPAC name | 2-(2-bromo-3,6-difluorophenyl)acetonitrile |
| InChIKey | VMVUSXZOFRZMBU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)CC#N)Br)F |
Computed by PubChem (NCBI)