Products 1257856-85-1
CAS 1257856-85-1 appears in our catalog under these names: Methyl 6-bromo-2,3-dichlorobenzoate, 95%, Methyl 6-bromo-2,3-dichlorobenzoate, ≥95%, ≥95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 10g, 1g, 250mg.
Methyl 6-bromo-2,3-dichlorobenzoate (CAS 1257856-85-1) is a chemical compound with the molecular formula C8H5BrCl2O2 and a molecular weight of 283.93 g/mol. IUPAC name: methyl 6-bromo-2,3-dichlorobenzoate. InChIKey: MYEFCOYNQLZZCE-UHFFFAOYSA-N.
| Molecular formula | C8H5BrCl2O2 |
|---|---|
| Molecular weight | 283.93 g/mol |
| IUPAC name | methyl 6-bromo-2,3-dichlorobenzoate |
| InChIKey | MYEFCOYNQLZZCE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1Cl)Cl)Br |
Computed by PubChem (NCBI)
Synonyms:
methyl 6-bromo-2,3-dichloro-benzoate