CAS 232277-30-4 appears in our catalog under these names: Methyl-3-bromo-2,6-dichloro benzoate, 95%, Methyl 3–bromo–2,6–dichlorobenzoate, Methyl 3-bromo-2,6-dichlorobenzoate, 96%, 96%, METHYL 3-BROMO-2,6-DICHLOROBENZOATE, 96%, Methyl 3-bromo-2,6-dichlorobenzoate, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 10g, 250mg, 100mg.
Methyl 3-bromo-2,6-dichlorobenzoate (CAS 232277-30-4) is a chemical compound with the molecular formula C8H5BrCl2O2 and a molecular weight of 283.93 g/mol. IUPAC name: methyl 3-bromo-2,6-dichlorobenzoate. InChIKey: AJLUIZCRLOMULY-UHFFFAOYSA-N.
| Molecular formula | C8H5BrCl2O2 |
|---|---|
| Molecular weight | 283.93 g/mol |
| IUPAC name | methyl 3-bromo-2,6-dichlorobenzoate |
| InChIKey | AJLUIZCRLOMULY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1Cl)Br)Cl |
Computed by PubChem (NCBI)