CAS 933585-62-7 appears in our catalog under these names: Methyl 3-bromo-2,5-dichlorobenzoate, 95%, Methyl 3-bromo-2,5-dichlorobenzoate, ≥95%, ≥95%, Methyl 3-bromo-2,5-dichlorobenzoate, ≥95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
Methyl 3-bromo-2,5-dichlorobenzoate (CAS 933585-62-7) is a chemical compound with the molecular formula C8H5BrCl2O2 and a molecular weight of 283.93 g/mol. IUPAC name: methyl 3-bromo-2,5-dichlorobenzoate. InChIKey: OHMVBWKRRWAFOK-UHFFFAOYSA-N.
| Molecular formula | C8H5BrCl2O2 |
|---|---|
| Molecular weight | 283.93 g/mol |
| IUPAC name | methyl 3-bromo-2,5-dichlorobenzoate |
| InChIKey | OHMVBWKRRWAFOK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC(=C1)Cl)Br)Cl |
Computed by PubChem (NCBI)