CAS 2055839-96-6 appears in our catalog under these names: Methyl 4-bromo-2,3-dichlorobenzoate, 95%, Methyl 4-bromo-2,3-dichlorobenzoate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
Methyl 4-bromo-2,3-dichlorobenzoate (CAS 2055839-96-6) is a chemical compound with the molecular formula C8H5BrCl2O2 and a molecular weight of 283.93 g/mol. IUPAC name: methyl 4-bromo-2,3-dichlorobenzoate. InChIKey: HUUZWLYNMDKOHP-UHFFFAOYSA-N.
| Molecular formula | C8H5BrCl2O2 |
|---|---|
| Molecular weight | 283.93 g/mol |
| IUPAC name | methyl 4-bromo-2,3-dichlorobenzoate |
| InChIKey | HUUZWLYNMDKOHP-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=C(C=C1)Br)Cl)Cl |
Computed by PubChem (NCBI)