CAS 1820705-16-5 appears in our catalog under these names: Methyl 3-bromo-2,4-dichlorobenzoate, 98%, methyl 3–bromo–2,4–dichlorobenzoate, Methyl 3-Bromo-2,4-Dichlorobenzoate, 98%, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 10g, 5g, 1g, 100mg.
Methyl 3-bromo-2,4-dichlorobenzoate (CAS 1820705-16-5) is a chemical compound with the molecular formula C8H5BrCl2O2 and a molecular weight of 283.93 g/mol. IUPAC name: methyl 3-bromo-2,4-dichlorobenzoate. InChIKey: ZIWOCRDNAABQFE-UHFFFAOYSA-N.
| Molecular formula | C8H5BrCl2O2 |
|---|---|
| Molecular weight | 283.93 g/mol |
| IUPAC name | methyl 3-bromo-2,4-dichlorobenzoate |
| InChIKey | ZIWOCRDNAABQFE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=C(C=C1)Cl)Br)Cl |
Computed by PubChem (NCBI)