CAS 232275-53-5 appears in our catalog under these names: Methyl 4-bromo-2,6-dichlorobenzoate, 95%, 4-bromo-2,6-dichlorobenzoic acid methyl ester, Methyl 4-bromo-2,6-dichlorobenzoate, 98%, 98%, Methyl 4-bromo-2,6-dichlorobenzoate, 97%, Methyl 4-bromo-2,6-dichlorobenzoate, 98%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 10g, 25g, 1g, 250mg, 2,5g, 100mg.
Methyl 4-bromo-2,6-dichlorobenzoate (CAS 232275-53-5) is a chemical compound with the molecular formula C8H5BrCl2O2 and a molecular weight of 283.93 g/mol. IUPAC name: methyl 4-bromo-2,6-dichlorobenzoate. InChIKey: JEOFIYOVYSTDJH-UHFFFAOYSA-N.
| Molecular formula | C8H5BrCl2O2 |
|---|---|
| Molecular weight | 283.93 g/mol |
| IUPAC name | methyl 4-bromo-2,6-dichlorobenzoate |
| InChIKey | JEOFIYOVYSTDJH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1Cl)Br)Cl |
Computed by PubChem (NCBI)