CAS 943975-32-4 appears in our catalog under these names: 2-Bromo-4,6-dichlorobenzoic acid methyl ester, 95%, 2-Bromo-4,6-dichlorobenzoic acid methyl ester, ≥95%, ≥95%, 2-Bromo-4,6-dichlorobenzoic acid methyl ester, ≥95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 250mg, 1g.
Methyl 2-bromo-4,6-dichlorobenzoate (CAS 943975-32-4) is a chemical compound with the molecular formula C8H5BrCl2O2 and a molecular weight of 283.93 g/mol. IUPAC name: methyl 2-bromo-4,6-dichlorobenzoate. InChIKey: BPKFEEIODHSYNG-UHFFFAOYSA-N.
| Molecular formula | C8H5BrCl2O2 |
|---|---|
| Molecular weight | 283.93 g/mol |
| IUPAC name | methyl 2-bromo-4,6-dichlorobenzoate |
| InChIKey | BPKFEEIODHSYNG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1Br)Cl)Cl |
Computed by PubChem (NCBI)