Products 1706436-37-4
CAS 1706436-37-4 is the registry number for 1-(4-Bromo-3-chloro-2-hydroxyphenyl)-2-chloroethanone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-(4-bromo-3-chloro-2-hydroxyphenyl)-2-chloroethanone (CAS 1706436-37-4) is a chemical compound with the molecular formula C8H5BrCl2O2 and a molecular weight of 283.93 g/mol. IUPAC name: 1-(4-bromo-3-chloro-2-hydroxyphenyl)-2-chloroethanone. InChIKey: VMXIJCAKLPMWOF-UHFFFAOYSA-N.
| Molecular formula | C8H5BrCl2O2 |
|---|---|
| Molecular weight | 283.93 g/mol |
| IUPAC name | 1-(4-bromo-3-chloro-2-hydroxyphenyl)-2-chloroethanone |
| InChIKey | VMXIJCAKLPMWOF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)CCl)O)Cl)Br |
Computed by PubChem (NCBI)