Products 125850-05-7
CAS 125850-05-7 is the registry number for Methyl 2,6-dichloro-5-methylpyridine-3-carboxylate, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 100mg, 50mg, 250mg, 1g, 5g.
Methyl 2,6-dichloro-5-methylpyridine-3-carboxylate (CAS 125850-05-7) is a chemical compound with the molecular formula C8H7Cl2NO2 and a molecular weight of 220.05 g/mol. IUPAC name: methyl 2,6-dichloro-5-methylpyridine-3-carboxylate. InChIKey: FFEOADOZNOOZBJ-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2NO2 |
|---|---|
| Molecular weight | 220.05 g/mol |
| IUPAC name | methyl 2,6-dichloro-5-methylpyridine-3-carboxylate |
| InChIKey | FFEOADOZNOOZBJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N=C1Cl)Cl)C(=O)OC |
Computed by PubChem (NCBI)