CAS 1258618-92-6 appears in our catalog under these names: 6-(3-Cyanophenyl)-2-formylphenol, 97%, 3'-Formyl-2'-hydroxy-(1,1'-biphenyl)-3-carbonitrile, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
3-(3-formyl-2-hydroxyphenyl)benzonitrile (CAS 1258618-92-6) is a chemical compound with the molecular formula C14H9NO2 and a molecular weight of 223.23 g/mol. IUPAC name: 3-(3-formyl-2-hydroxyphenyl)benzonitrile. InChIKey: OGDANKKNPVLHPK-UHFFFAOYSA-N.
| Molecular formula | C14H9NO2 |
|---|---|
| Molecular weight | 223.23 g/mol |
| IUPAC name | 3-(3-formyl-2-hydroxyphenyl)benzonitrile |
| InChIKey | OGDANKKNPVLHPK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2=CC=CC(=C2O)C=O)C#N |
Computed by PubChem (NCBI)