CAS 1258639-52-9 is the registry number for 2-{5,7-Dimethyl-2-oxo-1H,2H-pyrazolo(1,5-a)pyrimidin-6-yl}acetic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
2-(5,7-dimethyl-2-oxo-1H-pyrazolo[1,5-a]pyrimidin-6-yl)acetic acid (CAS 1258639-52-9) is a chemical compound with the molecular formula C10H11N3O3 and a molecular weight of 221.21 g/mol. IUPAC name: 2-(5,7-dimethyl-2-oxo-1H-pyrazolo[1,5-a]pyrimidin-6-yl)acetic acid. InChIKey: RNOUPZUEZPCCEM-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O3 |
|---|---|
| Molecular weight | 221.21 g/mol |
| IUPAC name | 2-(5,7-dimethyl-2-oxo-1H-pyrazolo[1,5-a]pyrimidin-6-yl)acetic acid |
| InChIKey | RNOUPZUEZPCCEM-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC2=CC(=O)NN12)C)CC(=O)O |
Computed by PubChem (NCBI)