Products 1260814-20-7

CAS 1260814-20-7 appears in our catalog under these names: 4–Cyano–2–iodobenzoic acid, 4-Cyano-2-iodobenzoic acid 95%. Offered by: GLPBio, Ambeed. Available pack sizes: 100mg, 1g, 250mg, 25mg, 50mg.

Structural formula: {0} (CAS {1})

4-cyano-2-iodobenzoic acid (CAS 1260814-20-7) is a chemical compound with the molecular formula C8H4INO2 and a molecular weight of 273.03 g/mol. IUPAC name: 4-cyano-2-iodobenzoic acid. InChIKey: OWTQANSUZFJZRT-UHFFFAOYSA-N.

Identity
Molecular formulaC8H4INO2
Molecular weight273.03 g/mol
IUPAC name4-cyano-2-iodobenzoic acid
InChIKeyOWTQANSUZFJZRT-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1C#N)I)C(=O)O

Computed by PubChem (NCBI)