CAS 126120-83-0 is the registry number for 4-Acetyl-2,2-difluoro-1,3-benzodioxole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-(2,2-difluoro-1,3-benzodioxol-4-yl)ethanone (CAS 126120-83-0) is a chemical compound with the molecular formula C9H6F2O3 and a molecular weight of 200.14 g/mol. IUPAC name: 1-(2,2-difluoro-1,3-benzodioxol-4-yl)ethanone. InChIKey: FXQWZAIGWRETAQ-UHFFFAOYSA-N.
| Molecular formula | C9H6F2O3 |
|---|---|
| Molecular weight | 200.14 g/mol |
| IUPAC name | 1-(2,2-difluoro-1,3-benzodioxol-4-yl)ethanone |
| InChIKey | FXQWZAIGWRETAQ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C2C(=CC=C1)OC(O2)(F)F |
Computed by PubChem (NCBI)