CAS 136593-45-8 appears in our catalog under these names: 5-Acetyl-2,2-difluoro-1,3-benzodioxole, 95%, 1-(2,2-Difluorobenzo[d][1,3]dioxol-5-yl)ethanone 98%, 1-(2,2-Difluorobenzo[d][1,3]dioxol-5-yl)ethanone, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg.
1-(2,2-difluoro-1,3-benzodioxol-5-yl)ethanone (CAS 136593-45-8) is a chemical compound with the molecular formula C9H6F2O3 and a molecular weight of 200.14 g/mol. IUPAC name: 1-(2,2-difluoro-1,3-benzodioxol-5-yl)ethanone. InChIKey: BGHPIIBSWJDRLQ-UHFFFAOYSA-N.
| Molecular formula | C9H6F2O3 |
|---|---|
| Molecular weight | 200.14 g/mol |
| IUPAC name | 1-(2,2-difluoro-1,3-benzodioxol-5-yl)ethanone |
| InChIKey | BGHPIIBSWJDRLQ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(C=C1)OC(O2)(F)F |
Computed by PubChem (NCBI)