CAS 319457-34-6 is the registry number for 2-Acetyl-3,6-difluorobenzoic acid. Offered by: Biosynth. Available pack sizes: 2g.
2-acetyl-3,6-difluorobenzoic acid (CAS 319457-34-6) is a chemical compound with the molecular formula C9H6F2O3 and a molecular weight of 200.14 g/mol. IUPAC name: 2-acetyl-3,6-difluorobenzoic acid. InChIKey: IHGWIRJWNPNDTJ-UHFFFAOYSA-N.
| Molecular formula | C9H6F2O3 |
|---|---|
| Molecular weight | 200.14 g/mol |
| IUPAC name | 2-acetyl-3,6-difluorobenzoic acid |
| InChIKey | IHGWIRJWNPNDTJ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=CC(=C1C(=O)O)F)F |
Computed by PubChem (NCBI)