Products 1989657-57-9

CAS 1989657-57-9 is the registry number for Methyl 2,3-difluoro-4-formylbenzoate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Methyl 2,3-difluoro-4-formylbenzoate (CAS 1989657-57-9) is a chemical compound with the molecular formula C9H6F2O3 and a molecular weight of 200.14 g/mol. IUPAC name: methyl 2,3-difluoro-4-formylbenzoate. InChIKey: FYJMUWOTWLKYGI-UHFFFAOYSA-N.

Identity
Molecular formulaC9H6F2O3
Molecular weight200.14 g/mol
IUPAC namemethyl 2,3-difluoro-4-formylbenzoate
InChIKeyFYJMUWOTWLKYGI-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C(=C(C=C1)C=O)F)F

Computed by PubChem (NCBI)