CAS 1989657-57-9 is the registry number for Methyl 2,3-difluoro-4-formylbenzoate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
Methyl 2,3-difluoro-4-formylbenzoate (CAS 1989657-57-9) is a chemical compound with the molecular formula C9H6F2O3 and a molecular weight of 200.14 g/mol. IUPAC name: methyl 2,3-difluoro-4-formylbenzoate. InChIKey: FYJMUWOTWLKYGI-UHFFFAOYSA-N.
| Molecular formula | C9H6F2O3 |
|---|---|
| Molecular weight | 200.14 g/mol |
| IUPAC name | methyl 2,3-difluoro-4-formylbenzoate |
| InChIKey | FYJMUWOTWLKYGI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=C(C=C1)C=O)F)F |
Computed by PubChem (NCBI)