Products 2452345-05-8
CAS 2452345-05-8 is the registry number for 3,3-Difluoro-2,3-dihydrobenzofuran-7-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3,3-difluoro-2H-1-benzofuran-7-carboxylic acid (CAS 2452345-05-8) is a chemical compound with the molecular formula C9H6F2O3 and a molecular weight of 200.14 g/mol. IUPAC name: 3,3-difluoro-2H-1-benzofuran-7-carboxylic acid. InChIKey: OUVUFRUJESOMOX-UHFFFAOYSA-N.
| Molecular formula | C9H6F2O3 |
|---|---|
| Molecular weight | 200.14 g/mol |
| IUPAC name | 3,3-difluoro-2H-1-benzofuran-7-carboxylic acid |
| InChIKey | OUVUFRUJESOMOX-UHFFFAOYSA-N |
| SMILES | C1C(C2=CC=CC(=C2O1)C(=O)O)(F)F |
Computed by PubChem (NCBI)