CAS 496913-15-6 is the registry number for 3-(2,6-Difluorophenyl)-2-oxopropanoic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(2,6-difluorophenyl)-2-oxopropanoic acid (CAS 496913-15-6) is a chemical compound with the molecular formula C9H6F2O3 and a molecular weight of 200.14 g/mol. IUPAC name: 3-(2,6-difluorophenyl)-2-oxopropanoic acid. InChIKey: IDRZKSMSEYLLQU-UHFFFAOYSA-N.
| Molecular formula | C9H6F2O3 |
|---|---|
| Molecular weight | 200.14 g/mol |
| IUPAC name | 3-(2,6-difluorophenyl)-2-oxopropanoic acid |
| InChIKey | IDRZKSMSEYLLQU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)CC(=O)C(=O)O)F |
Computed by PubChem (NCBI)