Products 496913-15-6

CAS 496913-15-6 is the registry number for 3-(2,6-Difluorophenyl)-2-oxopropanoic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

3-(2,6-difluorophenyl)-2-oxopropanoic acid (CAS 496913-15-6) is a chemical compound with the molecular formula C9H6F2O3 and a molecular weight of 200.14 g/mol. IUPAC name: 3-(2,6-difluorophenyl)-2-oxopropanoic acid. InChIKey: IDRZKSMSEYLLQU-UHFFFAOYSA-N.

Identity
Molecular formulaC9H6F2O3
Molecular weight200.14 g/mol
IUPAC name3-(2,6-difluorophenyl)-2-oxopropanoic acid
InChIKeyIDRZKSMSEYLLQU-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1)F)CC(=O)C(=O)O)F

Computed by PubChem (NCBI)