CAS 1449280-48-1 appears in our catalog under these names: Methyl 2,6-difluoro-4-formylbenzoate, 95%, Methyl 2,6-difluoro-4-formylbenzoate, 98%, Methyl 2,6-difluoro-4-formylbenzoate. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.
Methyl 2,6-difluoro-4-formylbenzoate (CAS 1449280-48-1) is a chemical compound with the molecular formula C9H6F2O3 and a molecular weight of 200.14 g/mol. IUPAC name: methyl 2,6-difluoro-4-formylbenzoate. InChIKey: RQPHTZALQCXLPL-UHFFFAOYSA-N.
| Molecular formula | C9H6F2O3 |
|---|---|
| Molecular weight | 200.14 g/mol |
| IUPAC name | methyl 2,6-difluoro-4-formylbenzoate |
| InChIKey | RQPHTZALQCXLPL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1F)C=O)F |
Computed by PubChem (NCBI)