CAS 220239-71-4 is the registry number for Methyl 3,4-difluorobenzoylformate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
Methyl 2-(3,4-difluorophenyl)-2-oxoacetate (CAS 220239-71-4) is a chemical compound with the molecular formula C9H6F2O3 and a molecular weight of 200.14 g/mol. IUPAC name: methyl 2-(3,4-difluorophenyl)-2-oxoacetate. InChIKey: HSOUCZHPVUQOOZ-UHFFFAOYSA-N.
| Molecular formula | C9H6F2O3 |
|---|---|
| Molecular weight | 200.14 g/mol |
| IUPAC name | methyl 2-(3,4-difluorophenyl)-2-oxoacetate |
| InChIKey | HSOUCZHPVUQOOZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=O)C1=CC(=C(C=C1)F)F |
Computed by PubChem (NCBI)