Products 1261762-32-6
CAS 1261762-32-6 is the registry number for 2-(bromomethyl)-1-chloro-4-(trifluoromethoxy)benzene, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-(bromomethyl)-1-chloro-4-(trifluoromethoxy)benzene (CAS 1261762-32-6) is a chemical compound with the molecular formula C8H5BrClF3O and a molecular weight of 289.47 g/mol. IUPAC name: 2-(bromomethyl)-1-chloro-4-(trifluoromethoxy)benzene. InChIKey: DHXYRXZGGCHUEH-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClF3O |
|---|---|
| Molecular weight | 289.47 g/mol |
| IUPAC name | 2-(bromomethyl)-1-chloro-4-(trifluoromethoxy)benzene |
| InChIKey | DHXYRXZGGCHUEH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)(F)F)CBr)Cl |
Computed by PubChem (NCBI)