Products 1261935-37-8
CAS 1261935-37-8 appears in our catalog under these names: 6–(3,5–Dicarboxyphenyl)nicotinic acid, 5-(5-Carboxypyridin-2-yl)isophthalic acid, 95%, 95%, 6-(3,5-Dicarboxyphenyl)nicotinic acid, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
5-(5-carboxy-2-pyridinyl)benzene-1,3-dicarboxylic acid (CAS 1261935-37-8) is a chemical compound with the molecular formula C14H9NO6 and a molecular weight of 287.22 g/mol. IUPAC name: 5-(5-carboxy-2-pyridinyl)benzene-1,3-dicarboxylic acid. InChIKey: BNBRLMQMUPXKHD-UHFFFAOYSA-N.
| Molecular formula | C14H9NO6 |
|---|---|
| Molecular weight | 287.22 g/mol |
| IUPAC name | 5-(5-carboxy-2-pyridinyl)benzene-1,3-dicarboxylic acid |
| InChIKey | BNBRLMQMUPXKHD-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C(=O)O)C2=CC(=CC(=C2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)