CAS 1261948-84-8 appears in our catalog under these names: 5-(3,5-Dicarboxyphenyl)picolinic acid, 98%, 98%, 5-(6-Carboxypyridin-3-yl)isophthalic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
5-(6-carboxy-3-pyridinyl)benzene-1,3-dicarboxylic acid (CAS 1261948-84-8) is a chemical compound with the molecular formula C14H9NO6 and a molecular weight of 287.22 g/mol. IUPAC name: 5-(6-carboxy-3-pyridinyl)benzene-1,3-dicarboxylic acid. InChIKey: CVJYQEUMYJIICH-UHFFFAOYSA-N.
| Molecular formula | C14H9NO6 |
|---|---|
| Molecular weight | 287.22 g/mol |
| IUPAC name | 5-(6-carboxy-3-pyridinyl)benzene-1,3-dicarboxylic acid |
| InChIKey | CVJYQEUMYJIICH-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C2=CC(=CC(=C2)C(=O)O)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)