CAS 1314484-59-7 appears in our catalog under these names: 2–Nitro–(1,1'–biphenyl)–4,4'–dicarboxylic acid, 2-Nitro-[1,1'-biphenyl]-4,4'-dicarboxylic acid, 97%, 97%, 2-Nitro-[1,1'-biphenyl]-4,4'-dicarboxylic acid, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 25mg, 100mg, 250mg, 1g.
4-(4-carboxyphenyl)-3-nitrobenzoic acid (CAS 1314484-59-7) is a chemical compound with the molecular formula C14H9NO6 and a molecular weight of 287.22 g/mol. IUPAC name: 4-(4-carboxyphenyl)-3-nitrobenzoic acid. InChIKey: OTDUJVQMQBNMCD-UHFFFAOYSA-N.
| Molecular formula | C14H9NO6 |
|---|---|
| Molecular weight | 287.22 g/mol |
| IUPAC name | 4-(4-carboxyphenyl)-3-nitrobenzoic acid |
| InChIKey | OTDUJVQMQBNMCD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(C=C(C=C2)C(=O)O)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)