CAS 1261960-83-1 appears in our catalog under these names: 3-Amino-5-(3-hydroxyphenyl)benzoic acid, 95%, 5-Amino-3'-hydroxy-(1,1'-biphenyl)-3-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
3-amino-5-(3-hydroxyphenyl)benzoic acid (CAS 1261960-83-1) is a chemical compound with the molecular formula C13H11NO3 and a molecular weight of 229.23 g/mol. IUPAC name: 3-amino-5-(3-hydroxyphenyl)benzoic acid. InChIKey: IOGGMZONUCAXAU-UHFFFAOYSA-N.
| Molecular formula | C13H11NO3 |
|---|---|
| Molecular weight | 229.23 g/mol |
| IUPAC name | 3-amino-5-(3-hydroxyphenyl)benzoic acid |
| InChIKey | IOGGMZONUCAXAU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)O)C2=CC(=CC(=C2)N)C(=O)O |
Computed by PubChem (NCBI)