CAS 1262019-00-0 is the registry number for 3-(3,5-Difluoro-4-hydroxyphenyl)prop-2-enoic acid. Offered by: Biosynth. Available pack sizes: 10g, 1g.
(E)-3-(3,5-difluoro-4-hydroxyphenyl)prop-2-enoic acid (CAS 1262019-00-0) is a chemical compound with the molecular formula C9H6F2O3 and a molecular weight of 200.14 g/mol. IUPAC name: (E)-3-(3,5-difluoro-4-hydroxyphenyl)prop-2-enoic acid. InChIKey: UVDDPORSKADCPV-OWOJBTEDSA-N.
| Molecular formula | C9H6F2O3 |
|---|---|
| Molecular weight | 200.14 g/mol |
| IUPAC name | (E)-3-(3,5-difluoro-4-hydroxyphenyl)prop-2-enoic acid |
| InChIKey | UVDDPORSKADCPV-OWOJBTEDSA-N |
| SMILES | C1=C(C=C(C(=C1F)O)F)/C=C/C(=O)O |
Computed by PubChem (NCBI)