Products 1262858-65-0
CAS 1262858-65-0 is the registry number for 2-Amino-2-(3-bromophenyl)propanoic acid hydrochloride, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-amino-2-(3-bromophenyl)propanoic acid;hydrochloride (CAS 1262858-65-0) is a chemical compound with the molecular formula C9H11BrClNO2 and a molecular weight of 280.54 g/mol. IUPAC name: 2-amino-2-(3-bromophenyl)propanoic acid;hydrochloride. InChIKey: KRDMRTOPFNWXSU-UHFFFAOYSA-N.
| Molecular formula | C9H11BrClNO2 |
|---|---|
| Molecular weight | 280.54 g/mol |
| IUPAC name | 2-amino-2-(3-bromophenyl)propanoic acid;hydrochloride |
| InChIKey | KRDMRTOPFNWXSU-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=CC=C1)Br)(C(=O)O)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
2-Amino-2-(3-bromophenyl)propanoic acid hydrochloride, 2-Amino-2-(3-bromophenyl)propanoic acidhydrochloride, 2-amino-2-(3-bromophenyl)propanoic acid;hydrochloride, KRDMRTOPFNWXSU-UHFFFAOYSA-N, 2-amino-2-(3-bromo-phenyl)-propionic acid hydrochloride, 2-amino-2-(3-bromophenyl)-propionic acid hydrochloride