Products 1263378-95-5
CAS 1263378-95-5 is the registry number for 4-Methyl-1H-indazole-6-carboxylic acid, 98%. Offered by: Fluorochem. Available pack sizes: 250mg.
4-methyl-1H-indazole-6-carboxylic acid (CAS 1263378-95-5) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: 4-methyl-1H-indazole-6-carboxylic acid. InChIKey: RXIVLLIXGQIDJO-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 4-methyl-1H-indazole-6-carboxylic acid |
| InChIKey | RXIVLLIXGQIDJO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1C=NN2)C(=O)O |
Computed by PubChem (NCBI)