Products 1266854-36-7
CAS 1266854-36-7 is the registry number for 2-(4-Acetylbenzenesulfonyl)acetamide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(4-acetylphenyl)sulfonylacetamide (CAS 1266854-36-7) is a chemical compound with the molecular formula C10H11NO4S and a molecular weight of 241.27 g/mol. IUPAC name: 2-(4-acetylphenyl)sulfonylacetamide. InChIKey: ZWLACRHPYPYFDF-UHFFFAOYSA-N.
| Molecular formula | C10H11NO4S |
|---|---|
| Molecular weight | 241.27 g/mol |
| IUPAC name | 2-(4-acetylphenyl)sulfonylacetamide |
| InChIKey | ZWLACRHPYPYFDF-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)S(=O)(=O)CC(=O)N |
Computed by PubChem (NCBI)