CAS 1268816-58-5 is the registry number for 5-BROMO-4,7-DIFLUORO-1H-INDOLE, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-bromo-4,7-difluoro-1H-indole (CAS 1268816-58-5) is a chemical compound with the molecular formula C8H4BrF2N and a molecular weight of 232.02 g/mol. IUPAC name: 5-bromo-4,7-difluoro-1H-indole. InChIKey: ZSKUJKDBKPEJPF-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF2N |
|---|---|
| Molecular weight | 232.02 g/mol |
| IUPAC name | 5-bromo-4,7-difluoro-1H-indole |
| InChIKey | ZSKUJKDBKPEJPF-UHFFFAOYSA-N |
| SMILES | C1=CNC2=C1C(=C(C=C2F)Br)F |
Computed by PubChem (NCBI)