CAS 1269634-08-3 appears in our catalog under these names: Methyl 3-amino-3-(3-fluorophenyl)propanoate hydrochloride, Methyl 3-amino-3-(3-fluorophenyl)propanoate hydrochloride, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 250mg, 2,5g, 5g, 100mg, 1g.
Methyl 3-amino-3-(3-fluorophenyl)propanoate;hydrochloride (CAS 1269634-08-3) is a chemical compound with the molecular formula C10H13ClFNO2 and a molecular weight of 233.67 g/mol. IUPAC name: methyl 3-amino-3-(3-fluorophenyl)propanoate;hydrochloride. InChIKey: JYMOEQWCXPGHHI-UHFFFAOYSA-N.
| Molecular formula | C10H13ClFNO2 |
|---|---|
| Molecular weight | 233.67 g/mol |
| IUPAC name | methyl 3-amino-3-(3-fluorophenyl)propanoate;hydrochloride |
| InChIKey | JYMOEQWCXPGHHI-UHFFFAOYSA-N |
| SMILES | COC(=O)CC(C1=CC(=CC=C1)F)N.Cl |
Computed by PubChem (NCBI)