Products 478408-60-5
CAS 478408-60-5 appears in our catalog under these names: (S)-Methyl 3-amino-3-(3-fluorophenyl)propanoate hydrochloride, 97%, (S)-Methyl 3-amino-3-(3-fluorophenyl)propanoate hydrochloride, 97%, 97%. Offered by: Chemat Brand, Chemat, Fluorochem. Available pack sizes: on request, 100mg, 250mg, 1g.
Methyl (3S)-3-amino-3-(3-fluorophenyl)propanoate;hydrochloride (CAS 478408-60-5) is a chemical compound with the molecular formula C10H13ClFNO2 and a molecular weight of 233.67 g/mol. IUPAC name: methyl (3S)-3-amino-3-(3-fluorophenyl)propanoate;hydrochloride. InChIKey: JYMOEQWCXPGHHI-FVGYRXGTSA-N.
| Molecular formula | C10H13ClFNO2 |
|---|---|
| Molecular weight | 233.67 g/mol |
| IUPAC name | methyl (3S)-3-amino-3-(3-fluorophenyl)propanoate;hydrochloride |
| InChIKey | JYMOEQWCXPGHHI-FVGYRXGTSA-N |
| SMILES | COC(=O)C[C@@H](C1=CC(=CC=C1)F)N.Cl |
Computed by PubChem (NCBI)