Products 1270341-81-5
CAS 1270341-81-5 is the registry number for 3-Amino-3-(3,4-difluorophenyl)propanenitrile. Offered by: Biosynth. Available pack sizes: 2g, 1g, 5g.
3-amino-3-(3,4-difluorophenyl)propanenitrile (CAS 1270341-81-5) is a chemical compound with the molecular formula C9H8F2N2 and a molecular weight of 182.17 g/mol. IUPAC name: 3-amino-3-(3,4-difluorophenyl)propanenitrile. InChIKey: XFSPNMIPXSSKHI-UHFFFAOYSA-N.
| Molecular formula | C9H8F2N2 |
|---|---|
| Molecular weight | 182.17 g/mol |
| IUPAC name | 3-amino-3-(3,4-difluorophenyl)propanenitrile |
| InChIKey | XFSPNMIPXSSKHI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(CC#N)N)F)F |
Computed by PubChem (NCBI)