CAS 1429043-06-0 appears in our catalog under these names: 1-(Difluoromethyl)-1H-indol-4-amine, 95%, 1-(Difluoromethyl)-1H-indol-4-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-(difluoromethyl)indol-4-amine (CAS 1429043-06-0) is a chemical compound with the molecular formula C9H8F2N2 and a molecular weight of 182.17 g/mol. IUPAC name: 1-(difluoromethyl)indol-4-amine. InChIKey: SZMIEJOCXPSEQD-UHFFFAOYSA-N.
| Molecular formula | C9H8F2N2 |
|---|---|
| Molecular weight | 182.17 g/mol |
| IUPAC name | 1-(difluoromethyl)indol-4-amine |
| InChIKey | SZMIEJOCXPSEQD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C=CN(C2=C1)C(F)F)N |
Computed by PubChem (NCBI)