CAS 2049868-30-4 appears in our catalog under these names: 5-(3,5-Difluorophenyl)-4,5-dihydro-1h-pyrazole, 95%, 5-(3,5-Difluorophenyl)-4,5-dihydro-1H-pyrazole, >95%, >95%, 5-(3,5-Difluorophenyl)-4,5-dihydro-1H-pyrazole, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
5-(3,5-difluorophenyl)-4,5-dihydro-1H-pyrazole (CAS 2049868-30-4) is a chemical compound with the molecular formula C9H8F2N2 and a molecular weight of 182.17 g/mol. IUPAC name: 5-(3,5-difluorophenyl)-4,5-dihydro-1H-pyrazole. InChIKey: KEOSOURUUFSOEG-UHFFFAOYSA-N.
| Molecular formula | C9H8F2N2 |
|---|---|
| Molecular weight | 182.17 g/mol |
| IUPAC name | 5-(3,5-difluorophenyl)-4,5-dihydro-1H-pyrazole |
| InChIKey | KEOSOURUUFSOEG-UHFFFAOYSA-N |
| SMILES | C1C=NNC1C2=CC(=CC(=C2)F)F |
Computed by PubChem (NCBI)