Products 1510579-17-5
CAS 1510579-17-5 appears in our catalog under these names: 2–(2，5–difluorophenyl)–4，5–dihydro–1H–imidazole, 2-(2,5-difluorophenyl)-4,5-dihydro-1H-imidazole, 95%, 95%. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-(2,5-difluorophenyl)-4,5-dihydro-1H-imidazole (CAS 1510579-17-5) is a chemical compound with the molecular formula C9H8F2N2 and a molecular weight of 182.17 g/mol. IUPAC name: 2-(2,5-difluorophenyl)-4,5-dihydro-1H-imidazole. InChIKey: IWCWZBHHRUZVRK-UHFFFAOYSA-N.
| Molecular formula | C9H8F2N2 |
|---|---|
| Molecular weight | 182.17 g/mol |
| IUPAC name | 2-(2,5-difluorophenyl)-4,5-dihydro-1H-imidazole |
| InChIKey | IWCWZBHHRUZVRK-UHFFFAOYSA-N |
| SMILES | C1CN=C(N1)C2=C(C=CC(=C2)F)F |
Computed by PubChem (NCBI)