CAS 1381944-19-9 is the registry number for 6,7-Difluoro-1,2-dimethyl-1,3-benzodiazole, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 25g.
6,7-difluoro-1,2-dimethylbenzimidazole (CAS 1381944-19-9) is a chemical compound with the molecular formula C9H8F2N2 and a molecular weight of 182.17 g/mol. IUPAC name: 6,7-difluoro-1,2-dimethylbenzimidazole. InChIKey: BDSHFQPNCDFIKE-UHFFFAOYSA-N.
| Molecular formula | C9H8F2N2 |
|---|---|
| Molecular weight | 182.17 g/mol |
| IUPAC name | 6,7-difluoro-1,2-dimethylbenzimidazole |
| InChIKey | BDSHFQPNCDFIKE-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(N1C)C(=C(C=C2)F)F |
Computed by PubChem (NCBI)