CAS 1314987-78-4 appears in our catalog under these names: 1-Ethyl-6,7-difluorobenzimidazole, 98%, 1-Ethyl-6,7-difluoro-1H-benzo(d)imidazole, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 1g, 100g.
1-ethyl-6,7-difluorobenzimidazole (CAS 1314987-78-4) is a chemical compound with the molecular formula C9H8F2N2 and a molecular weight of 182.17 g/mol. IUPAC name: 1-ethyl-6,7-difluorobenzimidazole. InChIKey: XAZWKKRGQRHLPL-UHFFFAOYSA-N.
| Molecular formula | C9H8F2N2 |
|---|---|
| Molecular weight | 182.17 g/mol |
| IUPAC name | 1-ethyl-6,7-difluorobenzimidazole |
| InChIKey | XAZWKKRGQRHLPL-UHFFFAOYSA-N |
| SMILES | CCN1C=NC2=C1C(=C(C=C2)F)F |
Computed by PubChem (NCBI)