CAS 2428406-36-2 is the registry number for (S)-5-(3,5-Difluorophenyl)-4,5-dihydro-1H-pyrazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(5S)-5-(3,5-difluorophenyl)-4,5-dihydro-1H-pyrazole (CAS 2428406-36-2) is a chemical compound with the molecular formula C9H8F2N2 and a molecular weight of 182.17 g/mol. IUPAC name: (5S)-5-(3,5-difluorophenyl)-4,5-dihydro-1H-pyrazole. InChIKey: KEOSOURUUFSOEG-VIFPVBQESA-N.
| Molecular formula | C9H8F2N2 |
|---|---|
| Molecular weight | 182.17 g/mol |
| IUPAC name | (5S)-5-(3,5-difluorophenyl)-4,5-dihydro-1H-pyrazole |
| InChIKey | KEOSOURUUFSOEG-VIFPVBQESA-N |
| SMILES | C1C=NN[C@@H]1C2=CC(=CC(=C2)F)F |
Computed by PubChem (NCBI)