CAS 2654746-33-3 is the registry number for (R)-3-(1-Aminoethyl)-2,5-difluorobenzonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[(1R)-1-aminoethyl]-2,5-difluorobenzonitrile (CAS 2654746-33-3) is a chemical compound with the molecular formula C9H8F2N2 and a molecular weight of 182.17 g/mol. IUPAC name: 3-[(1R)-1-aminoethyl]-2,5-difluorobenzonitrile. InChIKey: RKUNPEIOHFQRJH-RXMQYKEDSA-N.
| Molecular formula | C9H8F2N2 |
|---|---|
| Molecular weight | 182.17 g/mol |
| IUPAC name | 3-[(1R)-1-aminoethyl]-2,5-difluorobenzonitrile |
| InChIKey | RKUNPEIOHFQRJH-RXMQYKEDSA-N |
| SMILES | C[C@H](C1=CC(=CC(=C1F)C#N)F)N |
Computed by PubChem (NCBI)