CAS 1213667-49-2 is the registry number for 4-((1S)-1-AMINOETHYL)-2,6-DIFLUOROBENZENECARBONITRILE, 95%. Offered by: AmBeed. Available pack sizes: 1g.
4-[(1S)-1-aminoethyl]-2,6-difluorobenzonitrile (CAS 1213667-49-2) is a chemical compound with the molecular formula C9H8F2N2 and a molecular weight of 182.17 g/mol. IUPAC name: 4-[(1S)-1-aminoethyl]-2,6-difluorobenzonitrile. InChIKey: BRVVUXSIUQMGBC-YFKPBYRVSA-N.
| Molecular formula | C9H8F2N2 |
|---|---|
| Molecular weight | 182.17 g/mol |
| IUPAC name | 4-[(1S)-1-aminoethyl]-2,6-difluorobenzonitrile |
| InChIKey | BRVVUXSIUQMGBC-YFKPBYRVSA-N |
| SMILES | C[C@@H](C1=CC(=C(C(=C1)F)C#N)F)N |
Computed by PubChem (NCBI)