Products 1272947-00-8
CAS 1272947-00-8 is the registry number for 2-(1-Phenylcyclopropyl)-4-oxazolecarboxylic Acid. Offered by: TRC. Available pack sizes: 250mg.
2-(1-phenylcyclopropyl)-1,3-oxazole-4-carboxylic acid (CAS 1272947-00-8) is a chemical compound with the molecular formula C13H11NO3 and a molecular weight of 229.23 g/mol. IUPAC name: 2-(1-phenylcyclopropyl)-1,3-oxazole-4-carboxylic acid. InChIKey: QVRGYNHYFOABCH-UHFFFAOYSA-N.
| Molecular formula | C13H11NO3 |
|---|---|
| Molecular weight | 229.23 g/mol |
| IUPAC name | 2-(1-phenylcyclopropyl)-1,3-oxazole-4-carboxylic acid |
| InChIKey | QVRGYNHYFOABCH-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=CC=CC=C2)C3=NC(=CO3)C(=O)O |
Computed by PubChem (NCBI)