Products 1273595-81-5
CAS 1273595-81-5 appears in our catalog under these names: 6-BROMO-5-FLUORO-INDAN-1-ONE, 97%, 6-Bromo-5-fluoro-2,3-dihydro-1H-inden-1-one, 97%, 6-Bromo-5-fluoro-2，3-dihydro-1H-inden-1-one, 97%. Offered by: Fluorochem, Ambeed, BLDpharm, Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 10g, 100g, 100mg.
6-bromo-5-fluoro-2,3-dihydroinden-1-one (CAS 1273595-81-5) is a chemical compound with the molecular formula C9H6BrFO and a molecular weight of 229.05 g/mol. IUPAC name: 6-bromo-5-fluoro-2,3-dihydroinden-1-one. InChIKey: UJFQGEGLVMENFO-UHFFFAOYSA-N.
| Molecular formula | C9H6BrFO |
|---|---|
| Molecular weight | 229.05 g/mol |
| IUPAC name | 6-bromo-5-fluoro-2,3-dihydroinden-1-one |
| InChIKey | UJFQGEGLVMENFO-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=CC(=C(C=C21)F)Br |
Computed by PubChem (NCBI)